C19H26O6 — CID 163004375
[(3aS,6S,6aR,9aS,9bR)-6a-hydroxy-6-methyl-3-methylidene-2,9-dioxo-4,5,6,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-9a-yl]methyl 2-methylpropanoate (PubChem CID 163004375) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(3aS,6S,6aR,9aS,9bR)-6a-hydroxy-6-methyl-3-methylidene-2,9-dioxo-4,5,6,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-9a-yl]methyl 2-methylpropanoate.
| Compound Name | [(3aS,6S,6aR,9aS,9bR)-6a-hydroxy-6-methyl-3-methylidene-2,9-dioxo-4,5,6,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-9a-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 163004375 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(3aS,6S,6aR,9aS,9bR)-6a-hydroxy-6-methyl-3-methylidene-2,9-dioxo-4,5,6,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-9a-yl]methyl 2-methylpropanoate |
| SMILES | C=C1C(=O)O[C@@H]2[C@H]1CC[C@H](C)[C@]1(O)CCC(=O)[C@@]21COC(=O)C(C)C |
| InChI | InChI=1S/C19H26O6/c1-10(2)16(21)24-9-18-14(20)7-8-19(18,23)11(3)5-6-13-12(4)17(22)25-15(13)18/h10-11,13,15,23H,4-9H2,1-3H3/t11-,13-,15+,18-,19+/m0/s1 |
| InChIKey | QKUZBNBDSGKJEJ-RNCSTSBQSA-N |
| XLogP | 1.79 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|