C43H36Cl3NO9S — CID 45273846
[(2R,3S,4S,5R,6R)-3,4-dibenzoyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate (PubChem CID 45273846) has the molecular formula C43H36Cl3NO9S and a molecular weight of 849.19 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-3,4-dibenzoyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate.
| Compound Name | [(2R,3S,4S,5R,6R)-3,4-dibenzoyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 45273846 |
| Molecular Formula | C43H36Cl3NO9S |
| Molecular Weight | 849.19 g/mol |
| Exact Mass | 847.12 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-3,4-dibenzoyloxy-5-[(1S)-1-phenyl-2-phenylsulfanylethoxy]-6-(2,2,2-trichloroethanimidoyl)oxyoxan-2-yl]methyl benzoate |
| SMILES | [H]/N=C(/O[C@H]1O[C@H](COC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@H]1O[C@H](CSc1ccccc1)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C43H36Cl3NO9S/c44-43(45,46)42(47)56-41-37(52-34(28-16-6-1-7-17-28)27-57-32-24-14-5-15-25-32)36(55-40(50)31-22-12-4-13-23-31)35(54-39(49)30-20-10-3-11-21-30)33(53-41)26-51-38(48)29-18-8-2-9-19-29/h1-25,33-37,41,47H,26-27H2/b47-42+/t33-,34-,35+,36+,37-,41-/m1/s1 |
| InChIKey | DYICBJZACQUKGA-QSPBDTTESA-N |
| XLogP | 9.30 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.19 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|