C20H24Cl2N4O — CID 45275022
N-[2-(benzylamino)ethyl]-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 45275022) has the molecular formula C20H24Cl2N4O and a molecular weight of 407.35 g/mol. Its IUPAC name is N-[2-(benzylamino)ethyl]-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(benzylamino)ethyl]-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 45275022 |
| Molecular Formula | C20H24Cl2N4O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[2-(benzylamino)ethyl]-1-(3,5-dichloro-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | O=C(NCCNCc1ccccc1)C1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C20H24Cl2N4O/c21-17-13-24-14-18(22)19(17)26-10-6-16(7-11-26)20(27)25-9-8-23-12-15-4-2-1-3-5-15/h1-5,13-14,16,23H,6-12H2,(H,25,27) |
| InChIKey | UVINSCAZTIORGY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|