C13H18ClIN4O — CID 70900591
N-(2-aminoethyl)-1-(3-chloro-5-iodo-4-pyridinyl)piperidine-4-carboxamide (PubChem CID 70900591) has the molecular formula C13H18ClIN4O and a molecular weight of 408.67 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(3-chloro-5-iodo-4-pyridinyl)piperidine-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(3-chloro-5-iodo-4-pyridinyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 70900591 |
| Molecular Formula | C13H18ClIN4O |
| Molecular Weight | 408.67 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-(2-aminoethyl)-1-(3-chloro-5-iodo-4-pyridinyl)piperidine-4-carboxamide |
| SMILES | NCCNC(=O)C1CCN(c2c(Cl)cncc2I)CC1 |
| InChI | InChI=1S/C13H18ClIN4O/c14-10-7-17-8-11(15)12(10)19-5-1-9(2-6-19)13(20)18-4-3-16/h7-9H,1-6,16H2,(H,18,20) |
| InChIKey | KJDZVWFZPWNUMB-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.67 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|