C30H56N4O7 — CID 45276064
N-[3-(4,7-diformyl-1,4,7-triazonan-1-yl)propyl]-2-[2-[2-(2-undec-10-enoxyethoxy)ethoxy]ethoxy]acetamide (PubChem CID 45276064) has the molecular formula C30H56N4O7 and a molecular weight of 584.80 g/mol. Its IUPAC name is N-[3-(4,7-diformyl-1,4,7-triazonan-1-yl)propyl]-2-[2-[2-(2-undec-10-enoxyethoxy)ethoxy]ethoxy]acetamide.
| Compound Name | N-[3-(4,7-diformyl-1,4,7-triazonan-1-yl)propyl]-2-[2-[2-(2-undec-10-enoxyethoxy)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 45276064 |
| Molecular Formula | C30H56N4O7 |
| Molecular Weight | 584.80 g/mol |
| Exact Mass | 584.41 |
| IUPAC Name | N-[3-(4,7-diformyl-1,4,7-triazonan-1-yl)propyl]-2-[2-[2-(2-undec-10-enoxyethoxy)ethoxy]ethoxy]acetamide |
| SMILES | C=CCCCCCCCCCOCCOCCOCCOCC(=O)NCCCN1CCN(C=O)CCN(C=O)CC1 |
| InChI | InChI=1S/C30H56N4O7/c1-2-3-4-5-6-7-8-9-10-20-38-21-22-39-23-24-40-25-26-41-27-30(37)31-12-11-13-32-14-16-33(28-35)18-19-34(29-36)17-15-32/h2,28-29H,1,3-27H2,(H,31,37) |
| InChIKey | OWMNXRDBJSOUNT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.80 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|