C24H19NO7S — CID 45276631
N-[4-(6,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]benzenesulfonamide (PubChem CID 45276631) has the molecular formula C24H19NO7S and a molecular weight of 465.48 g/mol. Its IUPAC name is N-[4-(6,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]benzenesulfonamide.
| Compound Name | N-[4-(6,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 45276631 |
| Molecular Formula | C24H19NO7S |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | N-[4-(6,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]benzenesulfonamide |
| SMILES | COc1cc2cc(C(=O)c3ccc(NS(=O)(=O)c4ccccc4)cc3)c(=O)oc2cc1OC |
| InChI | InChI=1S/C24H19NO7S/c1-30-21-13-16-12-19(24(27)32-20(16)14-22(21)31-2)23(26)15-8-10-17(11-9-15)25-33(28,29)18-6-4-3-5-7-18/h3-14,25H,1-2H3 |
| InChIKey | WKTVOGOVFGNXGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|