C20H28N4O2 — CID 45278746
7-deuterio-1,3-bis(1,1,2,2,3,3,3-heptadeuteriopropyl)-8-(1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-3-tricyclo[3.3.1.03,7]nonanyl)purine-2,6-dione (PubChem CID 45278746) has the molecular formula C20H28N4O2 and a molecular weight of 384.64 g/mol. Its IUPAC name is 7-deuterio-1,3-bis(1,1,2,2,3,3,3-heptadeuteriopropyl)-8-(1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-3-tricyclo[3.3.1.03,7]nonanyl)purine-2,6-dione.
| Compound Name | 7-deuterio-1,3-bis(1,1,2,2,3,3,3-heptadeuteriopropyl)-8-(1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-3-tricyclo[3.3.1.03,7]nonanyl)purine-2,6-dione |
|---|---|
| PubChem CID | 45278746 |
| Molecular Formula | C20H28N4O2 |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 384.40 |
| IUPAC Name | 7-deuterio-1,3-bis(1,1,2,2,3,3,3-heptadeuteriopropyl)-8-(1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-3-tricyclo[3.3.1.03,7]nonanyl)purine-2,6-dione |
| SMILES | [2H]n1c(C23C([2H])([2H])C4([2H])C([2H])([2H])C([2H])(C([2H])([2H])C2([2H])C4([2H])[2H])C3([2H])[2H])nc2c1c(=O)n(C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])c(=O)n2C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C20H28N4O2/c1-3-5-23-16-15(17(25)24(6-4-2)19(23)26)21-18(22-16)20-10-12-7-13(11-20)9-14(20)8-12/h12-14H,3-11H2,1-2H3,(H,21,22)/i1D3,2D3,3D2,4D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D,13D,14D/hD |
| InChIKey | PJBFVWGQFLYWCB-SWLAQQKSSA-N |
| XLogP | 2.78 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |