C22H34N4O2 — CID 46174531
1,3-bis(1,1,2,2-tetradeuteriopropyl)-8-[1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-7-(dideuteriomethyl)-3-methyl-3-bicyclo[3.3.1]nonanyl]-7H-purine-2,6-dione (PubChem CID 46174531) has the molecular formula C22H34N4O2 and a molecular weight of 409.68 g/mol. Its IUPAC name is 1,3-bis(1,1,2,2-tetradeuteriopropyl)-8-[1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-7-(dideuteriomethyl)-3-methyl-3-bicyclo[3.3.1]nonanyl]-7H-purine-2,6-dione.
| Compound Name | 1,3-bis(1,1,2,2-tetradeuteriopropyl)-8-[1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-7-(dideuteriomethyl)-3-methyl-3-bicyclo[3.3.1]nonanyl]-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 46174531 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 409.68 g/mol |
| Exact Mass | 409.41 |
| IUPAC Name | 1,3-bis(1,1,2,2-tetradeuteriopropyl)-8-[1,2,2,4,4,5,6,6,7,8,8,9,9-tridecadeuterio-7-(dideuteriomethyl)-3-methyl-3-bicyclo[3.3.1]nonanyl]-7H-purine-2,6-dione |
| SMILES | [2H]C([2H])C1([2H])C([2H])([2H])C2([2H])C([2H])([2H])C(C)(c3nc4c([nH]3)c(=O)n(C([2H])([2H])C([2H])([2H])C)c(=O)n4C([2H])([2H])C([2H])([2H])C)C([2H])([2H])C([2H])(C1([2H])[2H])C2([2H])[2H] |
| InChI | InChI=1S/C22H34N4O2/c1-5-7-25-18-17(19(27)26(8-6-2)21(25)28)23-20(24-18)22(4)12-15-9-14(3)10-16(11-15)13-22/h14-16H,5-13H2,1-4H3,(H,23,24)/i3D2,5D2,6D2,7D2,8D2,9D2,10D2,11D2,12D2,13D2,14D,15D,16D |
| InChIKey | RHVGTYFJVZCTQO-HUFMAXIMSA-N |
| XLogP | 3.81 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.68 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |