C22H21ClN4O4 — CID 45294211
4-[5-chloro-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxopyridazin-1-yl]benzoic acid (PubChem CID 45294211) has the molecular formula C22H21ClN4O4 and a molecular weight of 440.89 g/mol. Its IUPAC name is 4-[5-chloro-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxopyridazin-1-yl]benzoic acid.
| Compound Name | 4-[5-chloro-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxopyridazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 45294211 |
| Molecular Formula | C22H21ClN4O4 |
| Molecular Weight | 440.89 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-[5-chloro-4-[4-(2-methoxyphenyl)piperazin-1-yl]-6-oxopyridazin-1-yl]benzoic acid |
| SMILES | COc1ccccc1N1CCN(c2cnn(-c3ccc(C(=O)O)cc3)c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C22H21ClN4O4/c1-31-19-5-3-2-4-17(19)25-10-12-26(13-11-25)18-14-24-27(21(28)20(18)23)16-8-6-15(7-9-16)22(29)30/h2-9,14H,10-13H2,1H3,(H,29,30) |
| InChIKey | FKBLDYAFPPTGMM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.89 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |