C18H21N9O2S — CID 4531271
N-[5-[2-[2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 4531271) has the molecular formula C18H21N9O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is N-[5-[2-[2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[5-[2-[2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 4531271 |
| Molecular Formula | C18H21N9O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-[5-[2-[2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCN(CC)c1ccc(C=NNC(=O)Cc2nnc(NC(=O)c3ncn[nH]3)s2)cc1 |
| InChI | InChI=1S/C18H21N9O2S/c1-3-27(4-2)13-7-5-12(6-8-13)10-20-23-14(28)9-15-24-26-18(30-15)22-17(29)16-19-11-21-25-16/h5-8,10-11H,3-4,9H2,1-2H3,(H,23,28)(H,19,21,25)(H,22,26,29) |
| InChIKey | AWQTYHWASRJKRZ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 141.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_anil_di_alk(35)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|