C15H12N8O4S — CID 4240661
N-[5-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide (PubChem CID 4240661) has the molecular formula C15H12N8O4S and a molecular weight of 400.38 g/mol. Its IUPAC name is N-[5-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | N-[5-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 4240661 |
| Molecular Formula | C15H12N8O4S |
| Molecular Weight | 400.38 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[5-[2-[2-(1,3-benzodioxol-5-ylmethylidene)hydrazinyl]-2-oxoethyl]-1,3,4-thiadiazol-2-yl]-1H-1,2,4-triazole-5-carboxamide |
| SMILES | O=C(Cc1nnc(NC(=O)c2ncn[nH]2)s1)NN=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N8O4S/c24-11(20-17-5-8-1-2-9-10(3-8)27-7-26-9)4-12-21-23-15(28-12)19-14(25)13-16-6-18-22-13/h1-3,5-6H,4,7H2,(H,20,24)(H,16,18,22)(H,19,23,25) |
| InChIKey | DFQPHGPEILFHHL-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.38 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|