C19H29N3O6S2 — CID 45354773
4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide (PubChem CID 45354773) has the molecular formula C19H29N3O6S2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 45354773 |
| Molecular Formula | C19H29N3O6S2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)sulfonyl-N-(1,1-dioxothiolan-3-yl)-N',N'-dimethylbenzohydrazide |
| SMILES | CC1CN(S(=O)(=O)c2ccc(C(=O)N(C3CCS(=O)(=O)C3)N(C)C)cc2)CC(C)O1 |
| InChI | InChI=1S/C19H29N3O6S2/c1-14-11-21(12-15(2)28-14)30(26,27)18-7-5-16(6-8-18)19(23)22(20(3)4)17-9-10-29(24,25)13-17/h5-8,14-15,17H,9-13H2,1-4H3 |
| InChIKey | CJSZVUQXEJLYRN-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|