C24H20FN3O2S — CID 45355712
3-(4-fluorophenyl)-6-(4-hydroxyphenyl)-4-methyl-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 45355712) has the molecular formula C24H20FN3O2S and a molecular weight of 433.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6-(4-hydroxyphenyl)-4-methyl-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-6-(4-hydroxyphenyl)-4-methyl-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45355712 |
| Molecular Formula | C24H20FN3O2S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 3-(4-fluorophenyl)-6-(4-hydroxyphenyl)-4-methyl-N-phenyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccccc2)C(c2ccc(O)cc2)NC(=S)N1c1ccc(F)cc1 |
| InChI | InChI=1S/C24H20FN3O2S/c1-15-21(23(30)26-18-5-3-2-4-6-18)22(16-7-13-20(29)14-8-16)27-24(31)28(15)19-11-9-17(25)10-12-19/h2-14,22,29H,1H3,(H,26,30)(H,27,31) |
| InChIKey | ZTNRIMCZPFXIJC-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|