C10H13NO2 — CID 45361764
2,3-dimethoxy-6-prop-2-enylpyridine (PubChem CID 45361764) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,3-dimethoxy-6-prop-2-enylpyridine.
| Compound Name | 2,3-dimethoxy-6-prop-2-enylpyridine |
|---|---|
| PubChem CID | 45361764 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2,3-dimethoxy-6-prop-2-enylpyridine |
| SMILES | C=CCc1ccc(OC)c(OC)n1 |
| InChI | InChI=1S/C10H13NO2/c1-4-5-8-6-7-9(12-2)10(11-8)13-3/h4,6-7H,1,5H2,2-3H3 |
| InChIKey | DWNPBGILLMBQPP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|