C16H25N7O2 — CID 4536412
butyl-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide (PubChem CID 4536412) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is butyl-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide.
| Compound Name | butyl-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide |
|---|---|
| PubChem CID | 4536412 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | butyl-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)cyanamide |
| SMILES | CCCCN(C#N)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C16H25N7O2/c1-2-3-4-23(13-17)16-19-14(21-5-9-24-10-6-21)18-15(20-16)22-7-11-25-12-8-22/h2-12H2,1H3 |
| InChIKey | MYZAOKAPIITVIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 90.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|