About 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide
3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide (PubChem CID 45370258) has the molecular formula C22H30N4O4S2
and a molecular weight of 478.64 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide |
| PubChem CID | 45370258 |
| Molecular Formula | C22H30N4O4S2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)C2CS(=O)(=O)CC2N2CCN(c3ncccn3)CC2)cc1 |
| InChI | InChI=1S/C22H30N4O4S2/c1-22(2,3)17-5-7-18(8-6-17)32(29,30)20-16-31(27,28)15-19(20)25-11-13-26(14-12-25)21-23-9-4-10-24-21/h4-10,19-20H,11-16H2,1-3H3 |
| InChIKey | FWPJXLIAWIDFAX-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The IUPAC name of 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide (CID 45370258) is 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide.
What is the SMILES notation for 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The canonical SMILES for 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide is CC(C)(C)c1ccc(S(=O)(=O)C2CS(=O)(=O)CC2N2CCN(c3ncccn3)CC2)cc1.
What is the InChIKey of 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide?
The InChIKey is FWPJXLIAWIDFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30N4O4S2/c1-22(2,3)17-5-7-18(8-6-17)32(29,30)20-16-31(27,28)15-19(20)25-11-13-26(14-12-25)21-23-9-4-10-24-21/h4-10,19-20H,11-16H2,1-3H3.
What are the key properties of 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide?
3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide has a molecular weight of 478.64 g/mol, XLogP of 1.54, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)sulfonyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)thiolane 1,1-dioxide is sourced from PubChem (CID 45370258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).