C10H13N5O5 — CID 4543796
[[(5-nitro-2-pyridinyl)amino]carbamoylamino]methyl propanoate (PubChem CID 4543796) has the molecular formula C10H13N5O5 and a molecular weight of 283.24 g/mol. Its IUPAC name is [[(5-nitro-2-pyridinyl)amino]carbamoylamino]methyl propanoate.
| Compound Name | [[(5-nitro-2-pyridinyl)amino]carbamoylamino]methyl propanoate |
|---|---|
| PubChem CID | 4543796 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | [[(5-nitro-2-pyridinyl)amino]carbamoylamino]methyl propanoate |
| SMILES | CCC(=O)OCNC(=O)NNc1ccc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H13N5O5/c1-2-9(16)20-6-12-10(17)14-13-8-4-3-7(5-11-8)15(18)19/h3-5H,2,6H2,1H3,(H,11,13)(H2,12,14,17) |
| InChIKey | LSTXAQFRQDECML-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|