C22H21ClN2O4 — CID 4547499
propan-2-yl 2-[3-chloro-2,5-dioxo-4-(1-phenylethylamino)pyrrol-1-yl]benzoate (PubChem CID 4547499) has the molecular formula C22H21ClN2O4 and a molecular weight of 412.87 g/mol. Its IUPAC name is propan-2-yl 2-[3-chloro-2,5-dioxo-4-(1-phenylethylamino)pyrrol-1-yl]benzoate.
| Compound Name | propan-2-yl 2-[3-chloro-2,5-dioxo-4-(1-phenylethylamino)pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 4547499 |
| Molecular Formula | C22H21ClN2O4 |
| Molecular Weight | 412.87 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | propan-2-yl 2-[3-chloro-2,5-dioxo-4-(1-phenylethylamino)pyrrol-1-yl]benzoate |
| SMILES | CC(C)OC(=O)c1ccccc1N1C(=O)C(Cl)=C(NC(C)c2ccccc2)C1=O |
| InChI | InChI=1S/C22H21ClN2O4/c1-13(2)29-22(28)16-11-7-8-12-17(16)25-20(26)18(23)19(21(25)27)24-14(3)15-9-5-4-6-10-15/h4-14,24H,1-3H3 |
| InChIKey | VABVOCBRQGKZJV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.87 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|