C19H13Cl2F3N2O2 — CID 5140045
3-chloro-1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(1-phenylethylamino)pyrrole-2,5-dione (PubChem CID 5140045) has the molecular formula C19H13Cl2F3N2O2 and a molecular weight of 429.23 g/mol. Its IUPAC name is 3-chloro-1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(1-phenylethylamino)pyrrole-2,5-dione.
| Compound Name | 3-chloro-1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(1-phenylethylamino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 5140045 |
| Molecular Formula | C19H13Cl2F3N2O2 |
| Molecular Weight | 429.23 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 3-chloro-1-[2-chloro-5-(trifluoromethyl)phenyl]-4-(1-phenylethylamino)pyrrole-2,5-dione |
| SMILES | CC(NC1=C(Cl)C(=O)N(c2cc(C(F)(F)F)ccc2Cl)C1=O)c1ccccc1 |
| InChI | InChI=1S/C19H13Cl2F3N2O2/c1-10(11-5-3-2-4-6-11)25-16-15(21)17(27)26(18(16)28)14-9-12(19(22,23)24)7-8-13(14)20/h2-10,25H,1H3 |
| InChIKey | HBIZKACQZDETSE-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.23 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|