C11H19NO5 — CID 45483523
N-[(1S,3R,4S,5R,6R,7S)-4,5-dihydroxy-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]butanamide (PubChem CID 45483523) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is N-[(1S,3R,4S,5R,6R,7S)-4,5-dihydroxy-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]butanamide.
| Compound Name | N-[(1S,3R,4S,5R,6R,7S)-4,5-dihydroxy-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]butanamide |
|---|---|
| PubChem CID | 45483523 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[(1S,3R,4S,5R,6R,7S)-4,5-dihydroxy-3-(hydroxymethyl)-2-oxabicyclo[4.1.0]heptan-7-yl]butanamide |
| SMILES | CCCC(=O)N[C@@H]1[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]12 |
| InChI | InChI=1S/C11H19NO5/c1-2-3-6(14)12-8-7-10(16)9(15)5(4-13)17-11(7)8/h5,7-11,13,15-16H,2-4H2,1H3,(H,12,14)/t5-,7-,8+,9-,10-,11+/m1/s1 |
| InChIKey | KGYGXRDKQFUUEQ-WIPGOINTSA-N |
| XLogP | -1.62 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |