C22H29ClN2O2 — CID 45488536
3-chloro-4-[1-(cyclohexylmethyl)piperidin-4-yl]oxy-N-prop-2-ynylbenzamide (PubChem CID 45488536) has the molecular formula C22H29ClN2O2 and a molecular weight of 388.94 g/mol. Its IUPAC name is 3-chloro-4-[1-(cyclohexylmethyl)piperidin-4-yl]oxy-N-prop-2-ynylbenzamide.
| Compound Name | 3-chloro-4-[1-(cyclohexylmethyl)piperidin-4-yl]oxy-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 45488536 |
| Molecular Formula | C22H29ClN2O2 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 3-chloro-4-[1-(cyclohexylmethyl)piperidin-4-yl]oxy-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(OC2CCN(CC3CCCCC3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H29ClN2O2/c1-2-12-24-22(26)18-8-9-21(20(23)15-18)27-19-10-13-25(14-11-19)16-17-6-4-3-5-7-17/h1,8-9,15,17,19H,3-7,10-14,16H2,(H,24,26) |
| InChIKey | KMPVGHPFYRKAQY-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|