C28H39N5O — CID 45488985
2-[2-(cyclohexen-1-yl)ethylamino]-4-(cyclohexylmethylamino)-N-(2-phenylethyl)pyrimidine-5-carboxamide (PubChem CID 45488985) has the molecular formula C28H39N5O and a molecular weight of 461.65 g/mol. Its IUPAC name is 2-[2-(cyclohexen-1-yl)ethylamino]-4-(cyclohexylmethylamino)-N-(2-phenylethyl)pyrimidine-5-carboxamide.
| Compound Name | 2-[2-(cyclohexen-1-yl)ethylamino]-4-(cyclohexylmethylamino)-N-(2-phenylethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 45488985 |
| Molecular Formula | C28H39N5O |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.32 |
| IUPAC Name | 2-[2-(cyclohexen-1-yl)ethylamino]-4-(cyclohexylmethylamino)-N-(2-phenylethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1cnc(NCCC2=CCCCC2)nc1NCC1CCCCC1 |
| InChI | InChI=1S/C28H39N5O/c34-27(29-18-16-22-10-4-1-5-11-22)25-21-32-28(30-19-17-23-12-6-2-7-13-23)33-26(25)31-20-24-14-8-3-9-15-24/h1,4-5,10-12,21,24H,2-3,6-9,13-20H2,(H,29,34)(H2,30,31,32,33) |
| InChIKey | UUFUXZYVTDYYGQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|