C25H26FN3O5 — CID 45489300
ethyl 3-[[2-[3-cyclopentyl-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate (PubChem CID 45489300) has the molecular formula C25H26FN3O5 and a molecular weight of 467.50 g/mol. Its IUPAC name is ethyl 3-[[2-[3-cyclopentyl-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[3-cyclopentyl-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 45489300 |
| Molecular Formula | C25H26FN3O5 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | ethyl 3-[[2-[3-cyclopentyl-1-(4-fluorophenyl)-2,5-dioxoimidazolidin-4-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CC2C(=O)N(c3ccc(F)cc3)C(=O)N2C2CCCC2)c1 |
| InChI | InChI=1S/C25H26FN3O5/c1-2-34-24(32)16-6-5-7-18(14-16)27-22(30)15-21-23(31)29(20-12-10-17(26)11-13-20)25(33)28(21)19-8-3-4-9-19/h5-7,10-14,19,21H,2-4,8-9,15H2,1H3,(H,27,30) |
| InChIKey | XAOUHPHPRFKGBA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|