C19H9NO3 — CID 4558065
4-(1,2-dioxoacenaphthylen-5-yl)oxybenzonitrile (PubChem CID 4558065) has the molecular formula C19H9NO3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-(1,2-dioxoacenaphthylen-5-yl)oxybenzonitrile.
| Compound Name | 4-(1,2-dioxoacenaphthylen-5-yl)oxybenzonitrile |
|---|---|
| PubChem CID | 4558065 |
| Molecular Formula | C19H9NO3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 4-(1,2-dioxoacenaphthylen-5-yl)oxybenzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc3c4c(cccc24)C(=O)C3=O)cc1 |
| InChI | InChI=1S/C19H9NO3/c20-10-11-4-6-12(7-5-11)23-16-9-8-15-17-13(16)2-1-3-14(17)18(21)19(15)22/h1-9H |
| InChIKey | GOUVJJUYEQQDFR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|