C15H12N5O+ — CID 4558948
6-amino-2-oxo-7-prop-2-enyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile (PubChem CID 4558948) has the molecular formula C15H12N5O+ and a molecular weight of 278.30 g/mol. Its IUPAC name is 6-amino-2-oxo-7-prop-2-enyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile.
| Compound Name | 6-amino-2-oxo-7-prop-2-enyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 4558948 |
| Molecular Formula | C15H12N5O+ |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 6-amino-2-oxo-7-prop-2-enyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile |
| SMILES | C=CC[n+]1c(N)c(C#N)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C15H11N5O/c1-2-6-20-13(17)10(9-16)8-11-14(20)18-12-5-3-4-7-19(12)15(11)21/h2-5,7-8,17H,1,6H2/p+1 |
| InChIKey | DKZJPZKQJUDODY-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|