C22H20N5O2+ — CID 7472148
6-amino-7-[2-(4-methoxyphenyl)ethyl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile (PubChem CID 7472148) has the molecular formula C22H20N5O2+ and a molecular weight of 386.44 g/mol. Its IUPAC name is 6-amino-7-[2-(4-methoxyphenyl)ethyl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile.
| Compound Name | 6-amino-7-[2-(4-methoxyphenyl)ethyl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile |
|---|---|
| PubChem CID | 7472148 |
| Molecular Formula | C22H20N5O2+ |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 6-amino-7-[2-(4-methoxyphenyl)ethyl]-11-methyl-2-oxo-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3(8),4,6,9,11,13-hexaene-5-carbonitrile |
| SMILES | COc1ccc(CC[n+]2c(N)c(C#N)cc3c(=O)n4cccc(C)c4nc32)cc1 |
| InChI | InChI=1S/C22H19N5O2/c1-14-4-3-10-27-20(14)25-21-18(22(27)28)12-16(13-23)19(24)26(21)11-9-15-5-7-17(29-2)8-6-15/h3-8,10,12,24H,9,11H2,1-2H3/p+1 |
| InChIKey | GPZLIPYKFBOGPO-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|