C26H22FN4O3S+ — CID 2018079
6-amino-7-[(4-fluorophenyl)methyl]-11-methyl-5-(4-methylphenyl)sulfonyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one (PubChem CID 2018079) has the molecular formula C26H22FN4O3S+ and a molecular weight of 489.55 g/mol. Its IUPAC name is 6-amino-7-[(4-fluorophenyl)methyl]-11-methyl-5-(4-methylphenyl)sulfonyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | 6-amino-7-[(4-fluorophenyl)methyl]-11-methyl-5-(4-methylphenyl)sulfonyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 2018079 |
| Molecular Formula | C26H22FN4O3S+ |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 6-amino-7-[(4-fluorophenyl)methyl]-11-methyl-5-(4-methylphenyl)sulfonyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
| SMILES | Cc1ccc(S(=O)(=O)c2cc3c(=O)n4cccc(C)c4nc3[n+](Cc3ccc(F)cc3)c2N)cc1 |
| InChI | InChI=1S/C26H21FN4O3S/c1-16-5-11-20(12-6-16)35(33,34)22-14-21-25(29-24-17(2)4-3-13-30(24)26(21)32)31(23(22)28)15-18-7-9-19(27)10-8-18/h3-14,28H,15H2,1-2H3/p+1 |
| InChIKey | NUZVRHXBXFPMJL-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|