C26H24N5O3S+ — CID 2013223
6-amino-5-(3,4-dimethylphenyl)sulfonyl-11-methyl-7-(pyridin-3-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one (PubChem CID 2013223) has the molecular formula C26H24N5O3S+ and a molecular weight of 486.58 g/mol. Its IUPAC name is 6-amino-5-(3,4-dimethylphenyl)sulfonyl-11-methyl-7-(pyridin-3-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | 6-amino-5-(3,4-dimethylphenyl)sulfonyl-11-methyl-7-(pyridin-3-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 2013223 |
| Molecular Formula | C26H24N5O3S+ |
| Molecular Weight | 486.58 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 6-amino-5-(3,4-dimethylphenyl)sulfonyl-11-methyl-7-(pyridin-3-ylmethyl)-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
| SMILES | Cc1ccc(S(=O)(=O)c2cc3c(=O)n4cccc(C)c4nc3[n+](Cc3cccnc3)c2N)cc1C |
| InChI | InChI=1S/C26H23N5O3S/c1-16-8-9-20(12-18(16)3)35(33,34)22-13-21-25(29-24-17(2)6-5-11-30(24)26(21)32)31(23(22)27)15-19-7-4-10-28-14-19/h4-14,27H,15H2,1-3H3/p+1 |
| InChIKey | QODIGCNTGNYETQ-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.58 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|