C23H24BrN4O3S+ — CID 2000170
6-amino-5-(4-bromophenyl)sulfonyl-7-hexyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one (PubChem CID 2000170) has the molecular formula C23H24BrN4O3S+ and a molecular weight of 516.44 g/mol. Its IUPAC name is 6-amino-5-(4-bromophenyl)sulfonyl-7-hexyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | 6-amino-5-(4-bromophenyl)sulfonyl-7-hexyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 2000170 |
| Molecular Formula | C23H24BrN4O3S+ |
| Molecular Weight | 516.44 g/mol |
| Exact Mass | 515.07 |
| IUPAC Name | 6-amino-5-(4-bromophenyl)sulfonyl-7-hexyl-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
| SMILES | CCCCCC[n+]1c(N)c(S(=O)(=O)c2ccc(Br)cc2)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C23H23BrN4O3S/c1-2-3-4-6-14-28-21(25)19(32(30,31)17-11-9-16(24)10-12-17)15-18-22(28)26-20-8-5-7-13-27(20)23(18)29/h5,7-13,15,25H,2-4,6,14H2,1H3/p+1 |
| InChIKey | UEDUQWZJCPXGFA-UHFFFAOYSA-O |
| XLogP | 3.89 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|