C23H23N4O4S+ — CID 6959743
6-amino-5-(benzenesulfonyl)-13-methyl-7-[[(2R)-oxolan-2-yl]methyl]-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one (PubChem CID 6959743) has the molecular formula C23H23N4O4S+ and a molecular weight of 451.53 g/mol. Its IUPAC name is 6-amino-5-(benzenesulfonyl)-13-methyl-7-[[(2R)-oxolan-2-yl]methyl]-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one.
| Compound Name | 6-amino-5-(benzenesulfonyl)-13-methyl-7-[[(2R)-oxolan-2-yl]methyl]-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
|---|---|
| PubChem CID | 6959743 |
| Molecular Formula | C23H23N4O4S+ |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 6-amino-5-(benzenesulfonyl)-13-methyl-7-[[(2R)-oxolan-2-yl]methyl]-1,9-diaza-7-azoniatricyclo[8.4.0.03,8]tetradeca-3,5,7,9,11,13-hexaen-2-one |
| SMILES | Cc1ccc2nc3c(cc(S(=O)(=O)c4ccccc4)c(N)[n+]3C[C@H]3CCCO3)c(=O)n2c1 |
| InChI | InChI=1S/C23H22N4O4S/c1-15-9-10-20-25-22-18(23(28)26(20)13-15)12-19(32(29,30)17-7-3-2-4-8-17)21(24)27(22)14-16-6-5-11-31-16/h2-4,7-10,12-13,16,24H,5-6,11,14H2,1H3/p+1/t16-/m1/s1 |
| InChIKey | IQVFAJKHMJYKEP-MRXNPFEDSA-O |
| XLogP | 2.04 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|