C8H14Cl2O2S — CID 4560113
2-(butylsulfonylmethyl)-1,1-dichlorocyclopropane (PubChem CID 4560113) has the molecular formula C8H14Cl2O2S and a molecular weight of 245.17 g/mol. Its IUPAC name is 2-(butylsulfonylmethyl)-1,1-dichlorocyclopropane.
| Compound Name | 2-(butylsulfonylmethyl)-1,1-dichlorocyclopropane |
|---|---|
| PubChem CID | 4560113 |
| Molecular Formula | C8H14Cl2O2S |
| Molecular Weight | 245.17 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-(butylsulfonylmethyl)-1,1-dichlorocyclopropane |
| SMILES | CCCCS(=O)(=O)CC1CC1(Cl)Cl |
| InChI | InChI=1S/C8H14Cl2O2S/c1-2-3-4-13(11,12)6-7-5-8(7,9)10/h7H,2-6H2,1H3 |
| InChIKey | TXNREMHVOLYCPS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.17 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|