C8H10Cl4O2S — CID 6936312
(2R)-1,1-dichloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfonylmethyl]cyclopropane (PubChem CID 6936312) has the molecular formula C8H10Cl4O2S and a molecular weight of 312.05 g/mol. Its IUPAC name is (2R)-1,1-dichloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfonylmethyl]cyclopropane.
| Compound Name | (2R)-1,1-dichloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfonylmethyl]cyclopropane |
|---|---|
| PubChem CID | 6936312 |
| Molecular Formula | C8H10Cl4O2S |
| Molecular Weight | 312.05 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | (2R)-1,1-dichloro-2-[[(1S)-2,2-dichlorocyclopropyl]methylsulfonylmethyl]cyclopropane |
| SMILES | O=S(=O)(C[C@H]1CC1(Cl)Cl)C[C@@H]1CC1(Cl)Cl |
| InChI | InChI=1S/C8H10Cl4O2S/c9-7(10)1-5(7)3-15(13,14)4-6-2-8(6,11)12/h5-6H,1-4H2/t5-,6+ |
| InChIKey | HCHRVSLOUYCOSJ-OLQVQODUSA-N |
| XLogP | 2.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.05 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|