C20H24O15S3 — CID 4564160
2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene-11,12,24-trisulfonic acid (PubChem CID 4564160) has the molecular formula C20H24O15S3 and a molecular weight of 600.60 g/mol. Its IUPAC name is 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene-11,12,24-trisulfonic acid.
| Compound Name | 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene-11,12,24-trisulfonic acid |
|---|---|
| PubChem CID | 4564160 |
| Molecular Formula | C20H24O15S3 |
| Molecular Weight | 600.60 g/mol |
| Exact Mass | 600.03 |
| IUPAC Name | 2,5,8,15,18,21-hexaoxatricyclo[20.4.0.09,14]hexacosa-1(22),9,11,13,23,25-hexaene-11,12,24-trisulfonic acid |
| SMILES | O=S(=O)(O)c1ccc2c(c1)OCCOCCOc1cc(S(=O)(=O)O)c(S(=O)(=O)O)cc1OCCOCCO2 |
| InChI | InChI=1S/C20H24O15S3/c21-36(22,23)14-1-2-15-16(11-14)33-8-4-31-6-10-35-18-13-20(38(27,28)29)19(37(24,25)26)12-17(18)34-9-5-30-3-7-32-15/h1-2,11-13H,3-10H2,(H,21,22,23)(H,24,25,26)(H,27,28,29) |
| InChIKey | AXOGPRCAHMPSAU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.60 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|