C6H9F6O3P — CID 4574247
2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane (PubChem CID 4574247) has the molecular formula C6H9F6O3P and a molecular weight of 274.10 g/mol. Its IUPAC name is 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane.
| Compound Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 4574247 |
| Molecular Formula | C6H9F6O3P |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-[ethyl(2,2,2-trifluoroethoxy)phosphoryl]oxy-1,1,1-trifluoroethane |
| SMILES | CCP(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C6H9F6O3P/c1-2-16(13,14-3-5(7,8)9)15-4-6(10,11)12/h2-4H2,1H3 |
| InChIKey | LIKKZVFVRKNSHY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|