C6H10F4IO3P — CID 10428824
1-diethoxyphosphoryl-1,1,2,2-tetrafluoro-2-iodoethane (PubChem CID 10428824) has the molecular formula C6H10F4IO3P and a molecular weight of 364.01 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1,2,2-tetrafluoro-2-iodoethane.
| Compound Name | 1-diethoxyphosphoryl-1,1,2,2-tetrafluoro-2-iodoethane |
|---|---|
| PubChem CID | 10428824 |
| Molecular Formula | C6H10F4IO3P |
| Molecular Weight | 364.01 g/mol |
| Exact Mass | 363.93 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1,2,2-tetrafluoro-2-iodoethane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)I |
| InChI | InChI=1S/C6H10F4IO3P/c1-3-13-15(12,14-4-2)6(9,10)5(7,8)11/h3-4H2,1-2H3 |
| InChIKey | SSVVESAZHKDNQY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.01 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|