C35H32N4O11 — CID 4575845
2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 4575845) has the molecular formula C35H32N4O11 and a molecular weight of 684.66 g/mol. Its IUPAC name is 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 4575845 |
| Molecular Formula | C35H32N4O11 |
| Molecular Weight | 684.66 g/mol |
| Exact Mass | 684.21 |
| IUPAC Name | 2-[4-(dimethylamino)-3,5-dinitrophenyl]-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-8-methyl-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(c5cc([N+](=O)[O-])c(N(C)C)c([N+](=O)[O-])c5)C(=O)C4C3CC3=C2C(=O)C(C)=CC3=O)cc(OC)c1O |
| InChI | InChI=1S/C35H32N4O11/c1-16-10-26(40)23-15-22-19(20(29(23)32(16)41)7-6-17-11-27(49-4)33(42)28(12-17)50-5)8-9-21-30(22)35(44)37(34(21)43)18-13-24(38(45)46)31(36(2)3)25(14-18)39(47)48/h6-8,10-14,20-22,30,42H,9,15H2,1-5H3 |
| InChIKey | IYKWIZYPILGWIA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 199.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|