About 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide
3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide (PubChem CID 4577058) has the molecular formula C23H30N2O6S
and a molecular weight of 462.57 g/mol. Its IUPAC name is 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide.
Molecular Properties
| Compound Name | 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide |
| PubChem CID | 4577058 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide |
| SMILES | CCCC(=O)Nc1cc(C(=O)N(C)CC(OC)OC)ccc1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30N2O6S/c1-6-7-21(26)24-19-14-17(23(27)25(3)15-22(30-4)31-5)10-13-20(19)32(28,29)18-11-8-16(2)9-12-18/h8-14,22H,6-7,15H2,1-5H3,(H,24,26) |
| InChIKey | ZCDSVZIGXAVFDN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide?
The IUPAC name of 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide (CID 4577058) is 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide.
What is the SMILES notation for 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide?
The canonical SMILES for 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide is CCCC(=O)Nc1cc(C(=O)N(C)CC(OC)OC)ccc1S(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide?
The InChIKey is ZCDSVZIGXAVFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O6S/c1-6-7-21(26)24-19-14-17(23(27)25(3)15-22(30-4)31-5)10-13-20(19)32(28,29)18-11-8-16(2)9-12-18/h8-14,22H,6-7,15H2,1-5H3,(H,24,26).
What are the key properties of 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide?
3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide has a molecular weight of 462.57 g/mol, XLogP of 3.26, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(butanoylamino)-N-(2,2-dimethoxyethyl)-N-methyl-4-(4-methylphenyl)sulfonylbenzamide is sourced from PubChem (CID 4577058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).