C17H20N6O3 — CID 4581087
7-amino-N-(cyclohex-3-en-1-ylmethylideneamino)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 4581087) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 7-amino-N-(cyclohex-3-en-1-ylmethylideneamino)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-amino-N-(cyclohex-3-en-1-ylmethylideneamino)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4581087 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 7-amino-N-(cyclohex-3-en-1-ylmethylideneamino)-1,3-dimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cn1c(=O)c2cc(C(=O)NN=CC3CC=CCC3)c(N)nc2n(C)c1=O |
| InChI | InChI=1S/C17H20N6O3/c1-22-14-12(16(25)23(2)17(22)26)8-11(13(18)20-14)15(24)21-19-9-10-6-4-3-5-7-10/h3-4,8-10H,5-7H2,1-2H3,(H2,18,20)(H,21,24) |
| InChIKey | MJNRNJJQSIVKEZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|