C20H22N6O3 — CID 6179032
N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 6179032) has the molecular formula C20H22N6O3 and a molecular weight of 394.44 g/mol. Its IUPAC name is N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 6179032 |
| Molecular Formula | C20H22N6O3 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | N-[(Z)-[4-(dimethylamino)phenyl]methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc2c(cc1C(=O)N/N=C\c1ccc(N(C)C)cc1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C20H22N6O3/c1-12-15(10-16-17(22-12)25(4)20(29)26(5)19(16)28)18(27)23-21-11-13-6-8-14(9-7-13)24(2)3/h6-11H,1-5H3,(H,23,27)/b21-11- |
| InChIKey | CKRJDOOFHNPJNE-NHDPSOOVSA-N |
| XLogP | 0.77 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|