C18H16N6O6 — CID 6882759
N-[(E)-(3-hydroxy-5-nitrophenyl)methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 6882759) has the molecular formula C18H16N6O6 and a molecular weight of 412.36 g/mol. Its IUPAC name is N-[(E)-(3-hydroxy-5-nitrophenyl)methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-[(E)-(3-hydroxy-5-nitrophenyl)methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 6882759 |
| Molecular Formula | C18H16N6O6 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[(E)-(3-hydroxy-5-nitrophenyl)methylideneamino]-1,3,7-trimethyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1nc2c(cc1C(=O)N/N=C/c1cc(O)cc([N+](=O)[O-])c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C18H16N6O6/c1-9-13(7-14-15(20-9)22(2)18(28)23(3)17(14)27)16(26)21-19-8-10-4-11(24(29)30)6-12(25)5-10/h4-8,25H,1-3H3,(H,21,26)/b19-8+ |
| InChIKey | IECFEQSQQFSYLF-UFWORHAWSA-N |
| XLogP | 0.32 |
| TPSA | 161.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|