C18H14O4 — CID 4581321
2-(1,3-dioxo-2-phenylinden-2-yl)propanoic acid (PubChem CID 4581321) has the molecular formula C18H14O4 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-(1,3-dioxo-2-phenylinden-2-yl)propanoic acid.
| Compound Name | 2-(1,3-dioxo-2-phenylinden-2-yl)propanoic acid |
|---|---|
| PubChem CID | 4581321 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-(1,3-dioxo-2-phenylinden-2-yl)propanoic acid |
| SMILES | CC(C(=O)O)C1(c2ccccc2)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14O4/c1-11(17(21)22)18(12-7-3-2-4-8-12)15(19)13-9-5-6-10-14(13)16(18)20/h2-11H,1H3,(H,21,22) |
| InChIKey | URLGUCDTRRQRLX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|