C13H10ClNO4 — CID 707018
(2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoic acid (PubChem CID 707018) has the molecular formula C13H10ClNO4 and a molecular weight of 279.68 g/mol. Its IUPAC name is (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoic acid.
| Compound Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoic acid |
|---|---|
| PubChem CID | 707018 |
| Molecular Formula | C13H10ClNO4 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (2R)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoic acid |
| SMILES | C[C@@H](NC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C13H10ClNO4/c1-6(13(18)19)15-10-9(14)11(16)7-4-2-3-5-8(7)12(10)17/h2-6,15H,1H3,(H,18,19)/t6-/m1/s1 |
| InChIKey | MRUSKBUGIISWRQ-ZCFIWIBFSA-N |
| XLogP | 1.58 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|