C16H15ClNO4- — CID 3404349
2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-4-methylpentanoate (PubChem CID 3404349) has the molecular formula C16H15ClNO4- and a molecular weight of 320.75 g/mol. Its IUPAC name is 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-4-methylpentanoate.
| Compound Name | 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 3404349 |
| Molecular Formula | C16H15ClNO4- |
| Molecular Weight | 320.75 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC1=C(Cl)C(=O)c2ccccc2C1=O)C(=O)[O-] |
| InChI | InChI=1S/C16H16ClNO4/c1-8(2)7-11(16(21)22)18-13-12(17)14(19)9-5-3-4-6-10(9)15(13)20/h3-6,8,11,18H,7H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | FOQCZPYGTIULFZ-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|