C14H12ClNO4 — CID 15889934
propan-2-yl N-(3-chloro-1,4-dioxonaphthalen-2-yl)carbamate (PubChem CID 15889934) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is propan-2-yl N-(3-chloro-1,4-dioxonaphthalen-2-yl)carbamate.
| Compound Name | propan-2-yl N-(3-chloro-1,4-dioxonaphthalen-2-yl)carbamate |
|---|---|
| PubChem CID | 15889934 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | propan-2-yl N-(3-chloro-1,4-dioxonaphthalen-2-yl)carbamate |
| SMILES | CC(C)OC(=O)NC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12ClNO4/c1-7(2)20-14(19)16-11-10(15)12(17)8-5-3-4-6-9(8)13(11)18/h3-7H,1-2H3,(H,16,19) |
| InChIKey | ARGBSTGFNRFMJY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|