C14H12ClNO4 — CID 2307587
methyl (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoate (PubChem CID 2307587) has the molecular formula C14H12ClNO4 and a molecular weight of 293.71 g/mol. Its IUPAC name is methyl (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoate.
| Compound Name | methyl (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoate |
|---|---|
| PubChem CID | 2307587 |
| Molecular Formula | C14H12ClNO4 |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl (2S)-2-[(3-chloro-1,4-dioxonaphthalen-2-yl)amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC1=C(Cl)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H12ClNO4/c1-7(14(19)20-2)16-11-10(15)12(17)8-5-3-4-6-9(8)13(11)18/h3-7,16H,1-2H3/t7-/m0/s1 |
| InChIKey | PTDPHHLHLBIHBI-ZETCQYMHSA-N |
| XLogP | 1.67 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|