C19H23N3OS2 — CID 4581357
3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-[1]benzothiolo[3,2-d]pyrimidin-4-one (PubChem CID 4581357) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is 3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-[1]benzothiolo[3,2-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4581357 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 3-[2-(2-ethylpiperidin-1-yl)ethyl]-2-sulfanylidene-1H-[1]benzothiolo[3,2-d]pyrimidin-4-one |
| SMILES | CCC1CCCCN1CCn1c(=S)[nH]c2c(sc3ccccc32)c1=O |
| InChI | InChI=1S/C19H23N3OS2/c1-2-13-7-5-6-10-21(13)11-12-22-18(23)17-16(20-19(22)24)14-8-3-4-9-15(14)25-17/h3-4,8-9,13H,2,5-7,10-12H2,1H3,(H,20,24) |
| InChIKey | RXEIHGFQHMHMFE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|