C25H22N2O2S — CID 44562932
14-[[(2R)-2-ethylpyrrolidin-1-yl]methyl]-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione (PubChem CID 44562932) has the molecular formula C25H22N2O2S and a molecular weight of 414.53 g/mol. Its IUPAC name is 14-[[(2R)-2-ethylpyrrolidin-1-yl]methyl]-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione.
| Compound Name | 14-[[(2R)-2-ethylpyrrolidin-1-yl]methyl]-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione |
|---|---|
| PubChem CID | 44562932 |
| Molecular Formula | C25H22N2O2S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 14-[[(2R)-2-ethylpyrrolidin-1-yl]methyl]-3-thia-14-azapentacyclo[10.7.1.02,10.04,9.016,20]icosa-1,4,6,8,10,12(20),16,18-octaene-13,15-dione |
| SMILES | CC[C@@H]1CCCN1CN1C(=O)c2cccc3c2c(cc2c4ccccc4sc32)C1=O |
| InChI | InChI=1S/C25H22N2O2S/c1-2-15-7-6-12-26(15)14-27-24(28)18-10-5-9-17-22(18)20(25(27)29)13-19-16-8-3-4-11-21(16)30-23(17)19/h3-5,8-11,13,15H,2,6-7,12,14H2,1H3/t15-/m1/s1 |
| InChIKey | ADKZETJMQRZCBI-OAHLLOKOSA-N |
| XLogP | 5.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|