C10H15N3S2 — CID 4581435
1-cyclohexyl-3-(1,3-thiazol-2-yl)thiourea (PubChem CID 4581435) has the molecular formula C10H15N3S2 and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,3-thiazol-2-yl)thiourea.
| Compound Name | 1-cyclohexyl-3-(1,3-thiazol-2-yl)thiourea |
|---|---|
| PubChem CID | 4581435 |
| Molecular Formula | C10H15N3S2 |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-cyclohexyl-3-(1,3-thiazol-2-yl)thiourea |
| SMILES | S=C(Nc1nccs1)NC1CCCCC1 |
| InChI | InChI=1S/C10H15N3S2/c14-9(13-10-11-6-7-15-10)12-8-4-2-1-3-5-8/h6-8H,1-5H2,(H2,11,12,13,14) |
| InChIKey | LHJQCIXRAYSBKF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|