C10H13N3S2 — CID 842043
[2-(cyclohexylamino)-1,3-thiazol-5-yl] thiocyanate (PubChem CID 842043) has the molecular formula C10H13N3S2 and a molecular weight of 239.37 g/mol. Its IUPAC name is [2-(cyclohexylamino)-1,3-thiazol-5-yl] thiocyanate.
| Compound Name | [2-(cyclohexylamino)-1,3-thiazol-5-yl] thiocyanate |
|---|---|
| PubChem CID | 842043 |
| Molecular Formula | C10H13N3S2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | [2-(cyclohexylamino)-1,3-thiazol-5-yl] thiocyanate |
| SMILES | N#CSc1cnc(NC2CCCCC2)s1 |
| InChI | InChI=1S/C10H13N3S2/c11-7-14-9-6-12-10(15-9)13-8-4-2-1-3-5-8/h6,8H,1-5H2,(H,12,13) |
| InChIKey | GKTKKZVFCLAHQX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|