C14H21N2O3+ — CID 4582758
[1-(1,3-benzodioxol-5-ylamino)-1-oxohexan-2-yl]-methylazanium (PubChem CID 4582758) has the molecular formula C14H21N2O3+ and a molecular weight of 265.33 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-ylamino)-1-oxohexan-2-yl]-methylazanium.
| Compound Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxohexan-2-yl]-methylazanium |
|---|---|
| PubChem CID | 4582758 |
| Molecular Formula | C14H21N2O3+ |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [1-(1,3-benzodioxol-5-ylamino)-1-oxohexan-2-yl]-methylazanium |
| SMILES | CCCCC([NH2+]C)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-3-4-5-11(15-2)14(17)16-10-6-7-12-13(8-10)19-9-18-12/h6-8,11,15H,3-5,9H2,1-2H3,(H,16,17)/p+1 |
| InChIKey | GSVMJPTVDMDYNE-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |